1-hydroxy-2-unsubstituted benzenoids
eMolecules 223127-00-2 | 4-(2-Hydroxyphenyl)benzoic acid | Combi-Blocks | MFCD06802564 | 214.220 | C13H10O3 | 97.000 | OC(=O)c1ccc(cc1)-c1ccccc1O | 1g | 117577082
4-(2-Hydroxyphenyl)benzoic acid | Combi-Blocks | 223127-00-2 | MFCD06802564 | 214.220 | C13H10O3 | 97.000 | OC(=O)c1ccc(cc1)-c1ccccc1O | 1g | 117577082
Medchemexpress LLC 4-hydroxybenzoic acid | 99-96-7 | MFCD00002547 | 100.0% | 138.12 | C7H6O3 | 1mL
4-Hydroxybenzoic acid a phenolic derivative of benzoic acid could inhibit most gram-positive and some gram-negative bacteria with an IC50 of 160 g/mL
Chemscene ChemScene | 4-Hydroxyphthalic acid | 25G | CS-D0572 | 0.98 | 610-35-5| MFCD00013984 | 182.13
ChemScene | 4-Hydroxyphthalic acid | 25G | CS-D0572 | 0.98 | 610-35-5| MFCD00013984 | 182.13
eMolecules 89466-08-0 | 2-Hydroxyphenylboronic acid | Oakwood Chemical | MFCD01074581 | 137.930 | C6H7BO3 | 98.000 | OB(O)c1ccccc1O | 1g | 537684491
2-Hydroxyphenylboronic acid | Oakwood Chemical | 89466-08-0 | MFCD01074581 | 137.930 | C6H7BO3 | 98.000 | OB(O)c1ccccc1O | 1g | 537684491
Medchemexpress LLC 3-(o-hydroxyphenyl)-5-phenyl-2-cyclohexen-1-one | 15156-56-6 | 100mg
3-(2-Hydroxyphenyl)-5-phenyl-2-cyclohexen-1-one is a Warfarin (HY-B0687) impurity
Chemscene ChemScene | 4-Bromo-3-hydroxybenzoic acid | 100G | CS-W003445 | 0.98 | 14348-38-0| MFCD08056371 | 217.018
ChemScene | 4-Bromo-3-hydroxybenzoic acid | 100G | CS-W003445 | 0.98 | 14348-38-0| MFCD08056371 | 217.018
Chem-Impex International, Inc. 4-Nitrophenol | 100-02-7 | MFCD00007331 | 250G
4-Nitrophenol, 100-02-7, MFCD00007331, 250G
Medchemexpress LLC HY-W015302 100mg Medchemexpress, 2-Aminobenzenesulfonic acid CAS:88-21-1 Purity:>98%
Medchemexpress, HY-W015590 100mg 2-Hydroxyphenylacetic acid CAS:614-75-5 2-Hydroxyphenylacetic acid is a potential biomarker for the food products, and found to be associated with phenylketonuria (PKU). Purity:>98% Medchemexpress has over 10000 novel life-science reagents, reference compounds, APIs and natural compounds for laboratory and scientific use. Other quantity can also be offered.
eMolecules 71597-85-8 | (4-hydroxyphenyl)boronic acid | Synthonix | MFCD01074628 | 137.930 | C6H7BO3 | 95.000 | OB(O)c1ccc(O)cc1 | 250g | 808576046
(4-hydroxyphenyl)boronic acid | Synthonix | 71597-85-8 | MFCD01074628 | 137.930 | C6H7BO3 | 95.000 | OB(O)c1ccc(O)cc1 | 250g | 808576046
eMolecules 958646-70-3 | (2-Chloro-6-hydroxyphenyl)boronic acid | Ambeed | MFCD18393225 | 172.370 | C6H6BClO3 | 98.000 | OB(O)c1c(O)cccc1Cl | 25g | 491653314
(2-Chloro-6-hydroxyphenyl)boronic acid | Ambeed | 958646-70-3 | MFCD18393225 | 172.370 | C6H6BClO3 | 98.000 | OB(O)c1c(O)cccc1Cl | 25g | 491653314